Difference between revisions of "CPD-204"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14812 RXN-14812] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* common name:
 +
** gibberellin A8
 +
* inchi key:
 +
** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
 +
* molecular weight:
 +
** 363.386   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA8
 +
** 2β-hydroxygibberellin 1
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-15709]][c] '''<=>''' 1 [[FRUCTOSE-6P]][c]
+
* [[RXN-115]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-fructose 6-phosphate[c] '''<=>''' 1 &beta;-D-fructofuranose 6-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A8}}
 +
{{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}}
 +
{{#set: molecular weight=363.386    }}
 +
{{#set: common name=GA8|2&beta;-hydroxygibberellin 1}}
 +
{{#set: produced by=RXN-115}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-204

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • common name:
    • gibberellin A8
  • inchi key:
    • InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
  • molecular weight:
    • 363.386
  • Synonym(s):
    • GA8
    • 2β-hydroxygibberellin 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-204&oldid=48099"