Difference between revisions of "CPD-11665"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15447 == * Synonym(s): == Reactions associated == * ADENOSINETRIPHOSPHATASE-RXN ** pantograph-esiliculosus == Pathways associa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * common name: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == |
+ | * smiles: | ||
+ | ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) | ||
+ | * common name: | ||
+ | ** serotonin O-sulfate | ||
+ | * inchi key: | ||
+ | ** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 256.276 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-hydroxytryptamine O-sulfate | ||
+ | ** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate | ||
+ | ** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester) | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10777]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.134104.html 134104] | ||
+ | {{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}} | ||
+ | {{#set: common name=serotonin O-sulfate}} | ||
+ | {{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=256.276 }} | ||
+ | {{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}} | ||
+ | {{#set: produced by=RXN-10777}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-11665
- smiles:
- C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
- common name:
- serotonin O-sulfate
- inchi key:
- InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
- molecular weight:
- 256.276
- Synonym(s):
- 5-hydroxytryptamine O-sulfate
- 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
- 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links