Difference between revisions of "CPD-8122"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16539 == * left end position: ** 3800 * transcription direction: ** POSITIVE * right end position: ** 4086 * centisome position: ** 88.4337...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == |
− | * | + | * smiles: |
− | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** molybdopterin adenine dinucleotide |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K |
− | * | + | * molecular weight: |
− | ** | + | ** 721.529 |
* Synonym(s): | * Synonym(s): | ||
+ | ** adenylated molybdopterin | ||
+ | ** H2Dtpp-mADP | ||
+ | ** molybdopterin-AMP | ||
+ | ** adenylyl-molybdopterin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8348]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727] |
− | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}} |
+ | {{#set: common name=molybdopterin adenine dinucleotide}} | ||
+ | {{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}} | ||
+ | {{#set: molecular weight=721.529 }} | ||
+ | {{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}} | ||
+ | {{#set: consumed by=RXN-8348}} |
Latest revision as of 21:22, 21 March 2018
Contents
Metabolite CPD-8122
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
- common name:
- molybdopterin adenine dinucleotide
- inchi key:
- InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
- molecular weight:
- 721.529
- Synonym(s):
- adenylated molybdopterin
- H2Dtpp-mADP
- molybdopterin-AMP
- adenylyl-molybdopterin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-" cannot be used as a page name in this wiki.