Difference between revisions of "CPD-14596"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
 
* common name:
 
* common name:
−
** 3-oxo-glutaryl-[acp] methyl ester synthase
+
** neolinustatin
−
** 3-oxoacyl-synthase
+
* inchi key:
−
* ec number:
+
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
−
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
* molecular weight:
 +
** 423.416   
 
* Synonym(s):
 
* Synonym(s):
 +
** butanenitrile
 +
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13603]]
−
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Malonyl-acp-methyl-ester]][c] '''=>''' 1 [[3-Ketoglutaryl-ACP-methyl-ester]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 a malonyl-[acp] methyl ester[c] '''=>''' 1 a 3-oxo-glutaryl-[acp] methyl ester[c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19302]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_15991]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_5939]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14485]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
−
** '''9''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=3-oxo-glutaryl-[acp] methyl ester synthase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
−
{{#set: common name=3-oxoacyl-synthase}}
+
* HMDB : HMDB38482
−
{{#set: ec number=EC-2.3.1.41}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_19302|Tiso_gene_15991|Tiso_gene_5939|Tiso_gene_14485}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
−
{{#set: in pathway=PWY-6519}}
+
* PUBCHEM:
−
{{#set: reconstruction category=orthology|annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
−
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
+
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=neolinustatin}}
 +
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
 +
{{#set: molecular weight=423.416    }}
 +
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
 +
{{#set: consumed by=RXN-13603}}

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-14596

  • smiles:
    • CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • common name:
    • neolinustatin
  • inchi key:
    • InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
  • molecular weight:
    • 423.416
  • Synonym(s):
    • butanenitrile
    • [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-14596&oldid=48248"