Difference between revisions of "CPD66-23"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20278 == * left end position: ** 379 * transcription direction: ** POSITIVE * right end position: ** 1538 * centisome position: ** 24.06349...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-23 CPD66-23] == * smiles: ** CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-23 CPD66-23] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** 17-α-hydroxypregnenolone |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JERGUCIJOXJXHF-TVWVXWENSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 332.482 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN66-350]] | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMST02030089 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91451 91451] |
| − | {{#set: | + | * HMDB : HMDB00363 |
| − | {{#set: reaction associated= | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.217096.html 217096] | |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28750 28750] | ||
| + | * METABOLIGHTS : MTBLC28750 | ||
| + | {{#set: smiles=CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=17-α-hydroxypregnenolone}} | ||
| + | {{#set: inchi key=InChIKey=JERGUCIJOXJXHF-TVWVXWENSA-N}} | ||
| + | {{#set: molecular weight=332.482 }} | ||
| + | {{#set: reversible reaction associated=RXN66-350}} | ||
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD66-23
- smiles:
- CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 17-α-hydroxypregnenolone
- inchi key:
- InChIKey=JERGUCIJOXJXHF-TVWVXWENSA-N
- molecular weight:
- 332.482
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMST02030089
- PUBCHEM:
- HMDB : HMDB00363
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC28750
"CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
