Difference between revisions of "CPDQT-40"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6903 RXN-6903] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_gamma_hydroxybutyrat...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(7'-m...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6903 RXN-6903] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
−
** probable_gamma_hydroxybutyrate_dehydrogenase
+
** 3-(7'-methylthio)heptylmalate
−
** gamma_hydroxybutyrate_dehydrogenase
+
* inchi key:
−
* ec number:
+
** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
−
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
+
* molecular weight:
 +
** 276.347   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(7'-methylthio)heptylmalic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXNQT-4178]]
−
** 1 [[PROTON]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[SUCC-S-ALD]][c] '''=>''' 1 [[4-HYDROXY-BUTYRATE]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NAD(P)H[c] '''+''' 1 succinate semialdehyde[c] '''=>''' 1 4-hydroxybutanoate[c] '''+''' 1 NAD(P)+[c]
+
* [[RXN-18200]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_777]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_91]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-4321]], L-glutamate degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4321 PWY-4321]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=probable_gamma_hydroxybutyrate_dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172]
−
{{#set: common name=gamma_hydroxybutyrate_dehydrogenase}}
+
{{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
−
{{#set: ec number=EC-1.1.1}}
+
{{#set: common name=3-(7'-methylthio)heptylmalate}}
−
{{#set: gene associated=Tiso_gene_777|Tiso_gene_91}}
+
{{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}}
−
{{#set: in pathway=PWY-4321}}
+
{{#set: molecular weight=276.347    }}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=3-(7'-methylthio)heptylmalic acid}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: consumed by=RXNQT-4178}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reversible reaction associated=RXN-18200}}

Latest revision as of 20:23, 21 March 2018

Metabolite CPDQT-40

  • smiles:
    • CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(7'-methylthio)heptylmalate
  • inchi key:
    • InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
  • molecular weight:
    • 276.347
  • Synonym(s):
    • 3-(7'-methylthio)heptylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPDQT-40&oldid=48311"