Difference between revisions of "CPD-4586"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16375 == * Synonym(s): == Reactions associated == * INORGPYROPHOSPHAT-RXN ** pantograph-esiliculosus == Pathways associated ==...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_16375 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] ==
 +
* smiles:
 +
** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
 +
* common name:
 +
** dihydrodemethylsterigmatocystin
 +
* inchi key:
 +
** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
 +
* molecular weight:
 +
** 312.278   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[INORGPYROPHOSPHAT-RXN]]
+
* [[RXN-9500]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7805]]
+
* [[PWY-7807]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=INORGPYROPHOSPHAT-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-7805|PWY-7807}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874]
 +
* HMDB : HMDB33658
 +
{{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}}
 +
{{#set: common name=dihydrodemethylsterigmatocystin}}
 +
{{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}}
 +
{{#set: molecular weight=312.278    }}
 +
{{#set: consumed by=RXN-9500}}

Latest revision as of 21:23, 21 March 2018

Metabolite CPD-4586

  • smiles:
    • C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
  • common name:
    • dihydrodemethylsterigmatocystin
  • inchi key:
    • InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
  • molecular weight:
    • 312.278
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))" cannot be used as a page name in this wiki.