Difference between revisions of "PWY-6074"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** zymosterol biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''4''' reactions found over '''12''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN3O-130]] |
| − | * | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_8263]] |
| − | + | ** 1 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[orthology-esiliculosus]] |
| − | * [[ | + | * [[RXN66-306]] |
| − | * | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_10982]] |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[orthology-esiliculosus]] |
| − | * | + | * [[RXN66-313]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * | + | *** [[Tiso_gene_897]] |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [[ | + | *** [[orthology-esiliculosus]] |
| − | * | + | * [[RXN66-318]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * | + | *** [[Tiso_gene_897]] |
| − | * [[ | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[orthology-esiliculosus]] |
| − | * [ | + | == Reaction(s) not found == |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-310 RXN66-310] |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-311 RXN66-311] |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-312 RXN66-312] |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-314 RXN66-314] |
| − | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-315 RXN66-315] | |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-316 RXN66-316] |
| − | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-317 RXN66-317] |
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN66-319 RXN66-319] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33154}} | |
| − | + | {{#set: common name=zymosterol biosynthesis}} | |
| − | + | {{#set: reaction found=4}} | |
| − | + | {{#set: total reaction=12}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 19:31, 21 March 2018
Pathway PWY-6074
- taxonomic range:
- common name:
- zymosterol biosynthesis
- Synonym(s):
Reaction(s) found
4 reactions found over 12 reactions in the full pathway
- RXN3O-130
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN66-306
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN66-313
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN66-318
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
