Difference between revisions of "CPD-710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12686 == * left end position: ** 4173 * transcription direction: ** NEGATIVE * right end position: ** 6777 * centisome position: ** 61.5577...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12686 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] ==
* left end position:
+
* smiles:
** 4173
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* common name:
** NEGATIVE
+
** campestanol
* right end position:
+
* inchi key:
** 6777
+
** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
* centisome position:
+
* molecular weight:
** 61.55775    
+
** 402.702    
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-campestanol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.1.64-RXN]]
+
* [[RXN-773]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
* [[CARBOXYLESTERASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10711]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-10767]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12252]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXN-12575]]
+
** in-silico_annotation
+
***ec-number
+
* [[RXNQT-4366]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-6857]]
+
* [[PWY-6303]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=4173}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394]
{{#set: right end position=6777}}
+
* CHEBI:
{{#set: centisome position=61.55775   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799]
{{#set: reaction associated=3.1.1.64-RXN|CARBOXYLESTERASE-RXN|RETINYL-PALMITATE-ESTERASE-RXN|RXN-10711|RXN-10767|RXN-12252|RXN-12575|RXNQT-4366}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-6857|PWY-6303}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=campestanol}}
 +
{{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}}
 +
{{#set: molecular weight=402.702   }}
 +
{{#set: common name=5α-campestanol}}
 +
{{#set: consumed by=RXN-773}}

Latest revision as of 20:24, 21 March 2018

Metabolite CPD-710

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • campestanol
  • inchi key:
    • InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
  • molecular weight:
    • 402.702
  • Synonym(s):
    • 5α-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.