Difference between revisions of "2-ACETO-LACTATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10254 == * left end position: ** 6520 * transcription direction: ** NEGATIVE * right end position: ** 8475 * centisome position: ** 75.0806...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * common name: ** (S)-2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10254 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] ==
−
* left end position:
+
* smiles:
−
** 6520
+
** CC(=O)C(C)(O)C(=O)[O-]
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** (S)-2-acetolactate
−
* right end position:
+
* inchi key:
−
** 8475
+
** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
−
* centisome position:
+
* molecular weight:
−
** 75.08061    
+
** 131.108    
 
* Synonym(s):
 
* Synonym(s):
 +
** (S)-2-hydroxy-2-methyl-3-oxobutanoate
 +
** α-acetolactate
 +
** (2S)-2-hydroxy-2-methyl-3-oxobutanoate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-12720]]
+
* [[RXN-6081]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[ACETOLACTSYN-RXN]]
−
** [[pantograph]]-[[athaliana]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
* [[ACETOLACTREDUCTOISOM-RXN]]
−
* [[SULFATE-ADENYLYLTRANS-RXN]]
+
* [[RXN-14037]]
−
** in-silico_annotation
+
−
***automated-name-match
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-6932]]
+
−
* [[DISSULFRED-PWY]]
+
−
* [[PWY-5340]]
+
−
* [[PWY-5278]]
+
−
* [[SULFMETII-PWY]]
+
−
* [[PWY-6683]]
+
−
* [[P224-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6520}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770]
−
{{#set: right end position=8475}}
+
* HMDB : HMDB06855
−
{{#set: centisome position=75.08061   }}
+
* LIGAND-CPD:
−
{{#set: reaction associated=RXN-12720|SULFATE-ADENYLYLTRANS-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010]
−
{{#set: pathway associated=PWY-6932|DISSULFRED-PWY|PWY-5340|PWY-5278|SULFMETII-PWY|PWY-6683|P224-PWY}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476]
 +
* BIGG : alac__S
 +
{{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}}
 +
{{#set: common name=(S)-2-acetolactate}}
 +
{{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}}
 +
{{#set: molecular weight=131.108   }}
 +
{{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}}
 +
{{#set: consumed by=RXN-6081}}
 +
{{#set: produced by=ACETOLACTSYN-RXN}}
 +
{{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN|RXN-14037}}

Latest revision as of 20:24, 21 March 2018

Metabolite 2-ACETO-LACTATE

  • smiles:
    • CC(=O)C(C)(O)C(=O)[O-]
  • common name:
    • (S)-2-acetolactate
  • inchi key:
    • InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
  • molecular weight:
    • 131.108
  • Synonym(s):
    • (S)-2-hydroxy-2-methyl-3-oxobutanoate
    • α-acetolactate
    • (2S)-2-hydroxy-2-methyl-3-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-ACETO-LACTATE&oldid=48507"