Difference between revisions of "CPD-16953"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLALD-DEHYDROG-RXN GLYCOLALD-DEHYDROG-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [ht...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * common name: ** 2-a...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLALD-DEHYDROG-RXN GLYCOLALD-DEHYDROG-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.2.1.21 EC-1.2.1.21]
+
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
 +
* inchi key:
 +
** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
 +
* molecular weight:
 +
** 223.234   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15733]]
−
** 1 [[WATER]][c] '''+''' 1 [[GLYCOLALDEHYDE]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[GLYCOLLATE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 glycolaldehyde[c] '''+''' 1 NAD+[c] '''=>''' 1 glycolate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7322]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
* [[PWY0-1280]], ethylene glycol degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1280 PWY0-1280]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[DARABCATK12-PWY]], D-arabinose degradation I: [http://metacyc.org/META/NEW-IMAGE?object=DARABCATK12-PWY DARABCATK12-PWY]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20001 20001]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804]
−
* LIGAND-RXN:
+
{{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R01333 R01333]
+
{{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}}
−
{{#set: ec number=EC-1.2.1.21}}
+
{{#set: molecular weight=223.234    }}
−
{{#set: gene associated=Tiso_gene_7322}}
+
{{#set: consumed by=RXN-15733}}
−
{{#set: in pathway=PWY0-1280|DARABCATK12-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction source=orthology-synechocystis}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 20:24, 21 March 2018

Metabolite CPD-16953

  • smiles:
    • CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
  • common name:
    • 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
  • inchi key:
    • InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
  • molecular weight:
    • 223.234
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-16953&oldid=48512"