Difference between revisions of "CPD0-2461"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL-2-DEHYDROGENASE-RXN RIBITOL-2-DEHYDROGENASE-RXN] == * direction: ** REVERSIBLE * ec number:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * common name: ** isoguanine...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == |
− | * | + | * smiles: |
− | ** | + | ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) |
− | * | + | * common name: |
− | ** | + | ** isoguanine |
+ | * inchi key: | ||
+ | ** InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 151.127 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-oxoadenine | ||
+ | ** 2-hydroxyadenine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15139]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=76900 76900] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.69351.html 69351] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62462 62462] |
− | + | * HMDB : HMDB00403 | |
− | {{#set: | + | {{#set: smiles=C2(=NC1(=C(NC(N=C(N)1)=O)N2))}} |
− | {{#set: | + | {{#set: common name=isoguanine}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N}} |
− | {{#set: | + | {{#set: molecular weight=151.127 }} |
− | {{#set: | + | {{#set: common name=2-oxoadenine|2-hydroxyadenine}} |
− | {{#set: | + | {{#set: produced by=RXN-15139}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD0-2461
- smiles:
- C2(=NC1(=C(NC(N=C(N)1)=O)N2))
- common name:
- isoguanine
- inchi key:
- InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
- molecular weight:
- 151.127
- Synonym(s):
- 2-oxoadenine
- 2-hydroxyadenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links