Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-tyrosine-O-sulfates Protein-tyrosine-O-sulfates] == * common name: ** a protein L-tyros...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == |
+ | * smiles: | ||
+ | ** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1) | ||
* common name: | * common name: | ||
− | ** | + | ** 5-enolpyruvoyl-shikimate 3-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J | ||
+ | * molecular weight: | ||
+ | ** 320.149 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-enolpyruvyl-shikimate 5-phosphate | ||
+ | ** 3-enolpyruvyl-shikimate-5-P | ||
+ | ** 5-O-(1-carboxyvinyl)-3-phosphoshikimate | ||
+ | ** 5-enolpyruvyl-shikimate 3-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[CHORISMATE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[2.5.1.19-RXN]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701] | ||
+ | * BIGG : 3psme | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269] | ||
+ | {{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}} | ||
+ | {{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}} | ||
+ | {{#set: molecular weight=320.149 }} | ||
+ | {{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}} | ||
+ | {{#set: consumed by=CHORISMATE-SYNTHASE-RXN}} | ||
+ | {{#set: reversible reaction associated=2.5.1.19-RXN}} |
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P
- smiles:
- C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
- common name:
- 5-enolpyruvoyl-shikimate 3-phosphate
- inchi key:
- InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
- molecular weight:
- 320.149
- Synonym(s):
- 3-enolpyruvyl-shikimate 5-phosphate
- 3-enolpyruvyl-shikimate-5-P
- 5-O-(1-carboxyvinyl)-3-phosphoshikimate
- 5-enolpyruvyl-shikimate 3-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)" cannot be used as a page name in this wiki.