Difference between revisions of "TROPINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7487 == * left end position: ** 5 * transcription direction: ** POSITIVE * right end position: ** 3280 * centisome position: ** 4.502881800...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == * smiles: ** C[N+]1(C2(CCC1CC(O)C2)) * common name: ** tropine * inchi key:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C[N+]1(C2(CCC1CC(O)C2)) |
| − | * | + | * common name: |
| − | ** | + | ** tropine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O |
| − | * | + | * molecular weight: |
| − | ** | + | ** 142.22 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[TROPINESTERASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[TROPINE-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 120-29-6 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00729 C00729] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57554 57554] |
| − | {{#set: | + | * NCI: |
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=43870 43870] | ||
| + | {{#set: smiles=C[N+]1(C2(CCC1CC(O)C2))}} | ||
| + | {{#set: common name=tropine}} | ||
| + | {{#set: inchi key=InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O}} | ||
| + | {{#set: molecular weight=142.22 }} | ||
| + | {{#set: produced by=TROPINESTERASE-RXN}} | ||
| + | {{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} | ||
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite TROPINE
- smiles:
- C[N+]1(C2(CCC1CC(O)C2))
- common name:
- tropine
- inchi key:
- InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O
- molecular weight:
- 142.22
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(O)C2))" cannot be used as a page name in this wiki.
