Difference between revisions of "DITP"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8573 == * left end position: ** 407 * transcription direction: ** POSITIVE * right end position: ** 2180 * centisome position: ** 4.030501...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITP DITP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
| − | * | + | * common name: |
| − | ** | + | ** dITP |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 488.137 |
* Synonym(s): | * Synonym(s): | ||
| + | ** deoxyinosine triphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-1602]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[RXN-14228]] |
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : ditp |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203822 25203822] |
| − | {{#set: | + | * HMDB : HMDB03537 |
| − | {{#set: reaction associated= | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01345 C01345] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61382 61382] | ||
| + | * METABOLIGHTS : MTBLC61382 | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
| + | {{#set: common name=dITP}} | ||
| + | {{#set: inchi key=InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J}} | ||
| + | {{#set: molecular weight=488.137 }} | ||
| + | {{#set: common name=deoxyinosine triphosphate}} | ||
| + | {{#set: consumed by=RXN0-1602}} | ||
| + | {{#set: reversible reaction associated=RXN-14228}} | ||
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite DITP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- common name:
- dITP
- inchi key:
- InChIKey=UFJPAQSLHAGEBL-RRKCRQDMSA-J
- molecular weight:
- 488.137
- Synonym(s):
- deoxyinosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : ditp
- PUBCHEM:
- HMDB : HMDB03537
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61382
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.
