Difference between revisions of "3-OCTAPRENYL-4-HYDROXYBENZOATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2320 == * left end position: ** 4629 * transcription direction: ** POSITIVE * right end position: ** 4897 * centisome position: ** 16.49620...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OCTAPRENYL-4-HYDROXYBENZOATE 3-OCTAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(=CCCC(=CCCC(=...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OCTAPRENYL-4-HYDROXYBENZOATE 3-OCTAPRENYL-4-HYDROXYBENZOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C |
− | * | + | * common name: |
− | ** | + | ** 3-octaprenyl-4-hydroxybenzoate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UTIBHEBNILDQKX-LQOKPSQISA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 682.06 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54685638 54685638] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5256806.html 5256806] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1617 1617] | ||
+ | * BIGG : 3ophb | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05809 C05809] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C}} | ||
+ | {{#set: common name=3-octaprenyl-4-hydroxybenzoate}} | ||
+ | {{#set: inchi key=InChIKey=UTIBHEBNILDQKX-LQOKPSQISA-M}} | ||
+ | {{#set: molecular weight=682.06 }} | ||
+ | {{#set: produced by=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN}} |
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C
- common name:
- 3-octaprenyl-4-hydroxybenzoate
- inchi key:
- InChIKey=UTIBHEBNILDQKX-LQOKPSQISA-M
- molecular weight:
- 682.06
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.