Difference between revisions of "Chap-ATP-Co-chaperone-SP-2Fe2S-Complex"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chap-ATP-Co-chaperone-SP-2Fe2S-Complex Chap-ATP-Co-chaperone-SP-2Fe2S-Complex] == * common name...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chap-ATP-Co-chaperone-SP-2Fe2S-Complex Chap-ATP-Co-chaperone-SP-2Fe2S-Complex] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [chaperone-ATP]-[co-chaperone]-[scaffold protein-(2Fe-2S)] complex |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14390]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14389]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a [chaperone-ATP]-[co-chaperone]-[scaffold protein-(2Fe-2S)] complex}} | |
− | + | {{#set: consumed by=RXN-14390}} | |
− | + | {{#set: produced by=RXN-14389}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: consumed by=RXN- | + | |
− | {{#set: produced by=RXN- | + | |
− | + |
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite Chap-ATP-Co-chaperone-SP-2Fe2S-Complex
- common name:
- a [chaperone-ATP]-[co-chaperone]-[scaffold protein-(2Fe-2S)] complex
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [chaperone-ATP]-[co-chaperone]-[scaffold protein-(2Fe-2S)] complex" cannot be used as a page name in this wiki.