Difference between revisions of "PWY-1269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * common name: ** 4-methylp...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1269 PWY-1269] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1269 PWY-1269] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1783257 TAX-1783257] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] | ||
* common name: | * common name: | ||
| − | ** | + | ** CMP-3-deoxy-D-manno-octulosonate biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** CMP-Kdo biosynthesis I |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[KDO-8PSYNTH-RXN]] |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_1350]] | ||
| + | *** [[Tiso_gene_20348]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=CPM-KDOSYNTH-RXN CPM-KDOSYNTH-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=DARAB5PISOM-RXN DARAB5PISOM-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=KDO-8PPHOSPHAT-RXN KDO-8PPHOSPHAT-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16804 RXN-16804] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-1269 PWY-1269] |
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: taxonomic range=TAX-1783257}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-1224}} |
| − | {{#set: common name= | + | {{#set: common name=CMP-3-deoxy-D-manno-octulosonate biosynthesis}} |
| − | {{#set: | + | {{#set: common name=CMP-Kdo biosynthesis I}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=20.0}} |
Latest revision as of 19:04, 21 March 2018
Pathway PWY-1269
- taxonomic range:
- common name:
- CMP-3-deoxy-D-manno-octulosonate biosynthesis
- Synonym(s):
- CMP-Kdo biosynthesis I
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- KDO-8PSYNTH-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
