Difference between revisions of "RXN1G-915"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-915 RXN1G-915] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-915 RXN1G-915] ==
−
* smiles:
+
* direction:
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** gibberellin A51
+
** trans-delta2-cis,cis-delta11,29-C48:3-[acyl-carrier protein] reductase
−
* inchi key:
+
* ec number:
−
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
+
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
−
* molecular weight:
+
−
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GA51
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-171]]
+
** 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[trans-D2-cis-cis-D11-29-C48-3-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D11-29-C48-2-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 a trans-delta2-cis,cis-delta11,29-C48:3-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta11,29-C48:2-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170022
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=trans-delta2-cis,cis-delta11,29-C48:3-[acyl-carrier protein] reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
+
{{#set: ec number=EC-1.3.1.M4}}
−
* HMDB : HMDB35041
+
{{#set: gene associated=Tiso_gene_10778}}
−
* CHEBI:
+
{{#set: in pathway=PWYG-321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: common name=gibberellin A51}}
+
−
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
+
−
{{#set: molecular weight=331.388    }}
+
−
{{#set: common name=GA51}}
+
−
{{#set: produced by=RXN-171}}
+

Latest revision as of 19:04, 21 March 2018

Reaction RXN1G-915

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-delta2-cis,cis-delta11,29-C48:3-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-delta2-cis,cis-delta11,29-C48:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-915&oldid=39308"