Difference between revisions of "PWY-6728"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] == * smiles: ** C(S(=O)(=O)[O-])C[N+] * common name: ** taurine * inchi key: *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183963 TAX-...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAURINE TAURINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728] ==
−
* smiles:
+
* taxonomic range:
−
** C(S(=O)(=O)[O-])C[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183963 TAX-183963]
 
* common name:
 
* common name:
−
** taurine
+
** methylaspartate cycle
−
* inchi key:
+
−
** InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 125.142   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-aminoethanesulfonate
 
−
** tauphon
 
−
** taufon
 
−
** 2-aminoethanesulfonic acid
 
−
** aminoetylsulphonic acid
 
−
** ethylaminesulphonic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN0-299]]
+
'''11''' reactions found over '''18''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[CITSYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18030]]
 +
*** [[Tiso_gene_9601]]
 +
*** [[Tiso_gene_9603]]
 +
*** [[Tiso_gene_9602]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3691]]
 +
*** [[Tiso_gene_6720]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2337]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[ISOCITDEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18262]]
 +
*** [[Tiso_gene_10809]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_2323]]
 +
*** [[Tiso_gene_1990]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[MALSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14377]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[METHYLMALONYL-COA-MUT-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9771]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5029]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15846]]
 +
*** [[Tiso_gene_11866]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLASPARTATE-AMMONIA-LYASE-RXN METHYLASPARTATE-AMMONIA-LYASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLASPARTATE-MUTASE-RXN METHYLASPARTATE-MUTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12168 RXN-12168]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8960 RXN-8960]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8961 RXN-8961]
 
== External links  ==
 
== External links  ==
−
* CAS : 107-35-7
+
{{#set: taxonomic range=TAX-183963}}
−
* BIGG : taur
+
{{#set: common name=methylaspartate cycle}}
−
* PUBCHEM:
+
{{#set: reaction found=11}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4068592 4068592]
+
{{#set: total reaction=18}}
−
* HMDB : HMDB00251
+
{{#set: completion rate=61.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00245 C00245]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=507393 507393]
+
−
* METABOLIGHTS : MTBLC507393
+
−
{{#set: smiles=C(S(=O)(=O)[O-])C[N+]}}
+
−
{{#set: common name=taurine}}
+
−
{{#set: inchi key=InChIKey=XOAAWQZATWQOTB-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=125.142    }}
+
−
{{#set: common name=2-aminoethanesulfonate|tauphon|taufon|2-aminoethanesulfonic acid|aminoetylsulphonic acid|ethylaminesulphonic acid}}
+
−
{{#set: consumed by=RXN0-299}}
+

Latest revision as of 19:04, 21 March 2018

Pathway PWY-6728

  • taxonomic range:
  • common name:
    • methylaspartate cycle
  • Synonym(s):

Reaction(s) found

11 reactions found over 18 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6728&oldid=39338"