Difference between revisions of "23S-rRNA-guanine-2445"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE ADENOSYLCOBINAMIDE] == * smiles: ** C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-guanine-2445 23S-rRNA-guanine-2445] == * common name: ** a guanine2445 in 23S rRNA * S...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE ADENOSYLCOBINAMIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-guanine-2445 23S-rRNA-guanine-2445] ==
−
* smiles:
+
−
** C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O
+
−
* inchi key:
+
−
** InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M
+
 
* common name:
 
* common name:
−
** adenosylcobinamide
+
** a guanine2445 in 23S rRNA
−
* molecular weight:
+
−
** 1240.332   
+
 
* Synonym(s):
 
* Synonym(s):
−
** AdoCbi
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11574]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[BTUR2-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a guanine2445 in 23S rRNA}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06508 C06508]
+
{{#set: consumed by=RXN-11574}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2480 2480]
+
−
* BIGG : adocbi
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819767 91819767]
+
−
* HMDB : HMDB06903
+
−
{{#set: smiles=C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O}}
+
−
{{#set: inchi key=InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M}}
+
−
{{#set: common name=adenosylcobinamide}}
+
−
{{#set: molecular weight=1240.332    }}
+
−
{{#set: common name=AdoCbi}}
+
−
{{#set: produced by=BTUR2-RXN}}
+

Latest revision as of 19:32, 21 March 2018

Metabolite 23S-rRNA-guanine-2445

  • common name:
    • a guanine2445 in 23S rRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=23S-rRNA-guanine-2445&oldid=42243"