Difference between revisions of "Oxo-glutarate-dehydro-suc-DH-lipoyl"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * common name: ** α-D-ribofur...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydro-suc-DH-lipoyl Oxo-glutarate-dehydro-suc-DH-lipoyl] == * common name: ** a...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydro-suc-DH-lipoyl Oxo-glutarate-dehydro-suc-DH-lipoyl] ==
−
* smiles:
+
−
** C(C1(C(C(C(O1)O)O)O))O
+
 
* common name:
 
* common name:
−
** α-D-ribofuranose
+
** a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine
−
* inchi key:
+
−
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
+
−
* molecular weight:
+
−
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α D-ribose
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RIBOKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2OXOGLUTDECARB-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-14904]]
+
* [[RXN0-1147]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
+
{{#set: produced by=2OXOGLUTDECARB-RXN}}
−
* CHEMSPIDER:
+
{{#set: reversible reaction associated=RXN0-1147}}
−
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
+
−
* HMDB : HMDB00283
+
−
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
+
−
{{#set: common name=α-D-ribofuranose}}
+
−
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
+
−
{{#set: molecular weight=150.131    }}
+
−
{{#set: common name=α D-ribose}}
+
−
{{#set: consumed by=RIBOKIN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14904}}
+

Latest revision as of 19:05, 21 March 2018

Metabolite Oxo-glutarate-dehydro-suc-DH-lipoyl

  • common name:
    • a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [2-oxoglutarate dehydrogenase E2 protein] N6-S-succinyldihydrolipoyl-L-lysine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Oxo-glutarate-dehydro-suc-DH-lipoyl&oldid=39419"