Difference between revisions of "Tiso gene 558"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * common name:...") |
(Created page with "Category:Gene == Gene Tiso_gene_558 == * right end position: ** 24347 * transcription direction: ** POSITIVE * left end position: ** 22467 * centisome position: ** 70.5932...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_558 == |
− | * | + | * right end position: |
− | ** | + | ** 24347 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 22467 |
− | * | + | * centisome position: |
− | ** | + | ** 70.59322 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-15556]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7511]] | |
== External links == | == External links == | ||
− | + | {{#set: right end position=24347}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=22467}} | |
− | + | {{#set: centisome position=70.59322 }} | |
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Gene Tiso_gene_558
- right end position:
- 24347
- transcription direction:
- POSITIVE
- left end position:
- 22467
- centisome position:
- 70.59322
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation