Difference between revisions of "PWY-6902"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * common...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-976 TAX-976] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] | ||
* common name: | * common name: | ||
− | ** | + | ** chitin degradation II (Vibrio) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[3. | + | '''3''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[3.2.1.14-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_10265]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-12625]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_1129]] | ||
+ | *** [[Tiso_gene_14122]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-12626]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_1129]] | ||
+ | *** [[Tiso_gene_14122]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12623 RXN-12623] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-323 TRANS-RXN-323] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: taxonomic range=TAX-201174}} | |
− | + | {{#set: taxonomic range=TAX-976}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=chitin degradation II (Vibrio)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=60.0}} | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Pathway PWY-6902
- taxonomic range:
- common name:
- chitin degradation II (Vibrio)
- Synonym(s):
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- 3.2.1.14-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-12625
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-12626
- 2 associated gene(s):
- 1 reconstruction source(s) associated: