Difference between revisions of "RXN-16133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * commo...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16133 RXN-16133] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyacyl-_dehydrogenase *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16133 RXN-16133] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyacyl-_dehydrogenase |
− | * | + | ** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit |
− | ** | + | ** hydroxyacyl-coenzyme_a_mitochondrial |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[L-3-HYDROXYACYL-COA]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[3-KETOACYL-COA]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 a (3S)-3-hydroxyacyl-CoA[c] '''+''' 1 NAD+[c] '''<=>''' 1 a 3-oxoacyl-CoA[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18838]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14262]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18839]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14026]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5857]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=3-hydroxyacyl-_dehydrogenase}} | |
− | + | {{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}} | |
− | + | {{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}} | |
− | + | {{#set: ec number=EC-1.1.1.35}} | |
− | + | {{#set: gene associated=Tiso_gene_18838|Tiso_gene_14262|Tiso_gene_18839|Tiso_gene_14026|Tiso_gene_5857}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Contents
Reaction RXN-16133
- direction:
- REVERSIBLE
- common name:
- 3-hydroxyacyl-_dehydrogenase
- hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
- hydroxyacyl-coenzyme_a_mitochondrial
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-3-HYDROXYACYL-COA[c] + 1 NAD[c] <=> 1 3-KETOACYL-COA[c] + 1 NADH[c] + 1 PROTON[c]
- With common name(s):
- 1 a (3S)-3-hydroxyacyl-CoA[c] + 1 NAD+[c] <=> 1 a 3-oxoacyl-CoA[c] + 1 NADH[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18838
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14262
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18839
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14026
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5857
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation