Difference between revisions of "RXN-16133"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * commo...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16133 RXN-16133] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyacyl-_dehydrogenase *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16133 RXN-16133] ==
* smiles:
+
* direction:
** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
** REVERSIBLE
 
* common name:
 
* common name:
** xanthosine
+
** 3-hydroxyacyl-_dehydrogenase
* inchi key:
+
** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
** InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N
+
** hydroxyacyl-coenzyme_a_mitochondrial
* molecular weight:
+
* ec number:
** 284.228   
+
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
** 9 β-D-ribofuranosylxanthine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN0-363]]
+
* With identifiers:
* [[XANTHOSINEPHOSPHORY-RXN]]
+
** 1 [[L-3-HYDROXYACYL-COA]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[3-KETOACYL-COA]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[X5NT]]
+
** 1 a (3S)-3-hydroxyacyl-CoA[c] '''+''' 1 NAD+[c] '''<=>''' 1 a 3-oxoacyl-CoA[c] '''+''' 1 NADH[c] '''+''' 1 H+[c]
* [[XMPXAN-RXN]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18838]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18839]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 146-80-5
+
{{#set: direction=REVERSIBLE}}
* BIGG : xtsn
+
{{#set: common name=3-hydroxyacyl-_dehydrogenase}}
* PUBCHEM:
+
{{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=64959 64959]
+
{{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}}
* HMDB : HMDB00299
+
{{#set: ec number=EC-1.1.1.35}}
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_18838|Tiso_gene_14262|Tiso_gene_18839|Tiso_gene_14026|Tiso_gene_5857}}
** [http://www.genome.jp/dbget-bin/www_bget?C01762 C01762]
+
{{#set: in pathway=}}
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
** [http://www.chemspider.com/Chemical-Structure.1152.html 1152]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18107 18107]
+
* METABOLIGHTS : MTBLC18107
+
{{#set: smiles=C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
{{#set: common name=xanthosine}}
+
{{#set: inchi key=InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N}}
+
{{#set: molecular weight=284.228    }}
+
{{#set: common name=9 &beta;-D-ribofuranosylxanthine}}
+
{{#set: consumed by=RXN0-363|XANTHOSINEPHOSPHORY-RXN}}
+
{{#set: produced by=X5NT|XMPXAN-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Reaction RXN-16133

  • direction:
    • REVERSIBLE
  • common name:
    • 3-hydroxyacyl-_dehydrogenase
    • hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
    • hydroxyacyl-coenzyme_a_mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links