Difference between revisions of "Tiso gene 18325"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_18325 == * Synonym(s): == Reactions associated == * Reaction: AMACETOXID-RXN ** Source: orthology-creinhardtii == Pathways associa...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Gene Tiso_gene_18325 ==
* smiles:
+
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* common name:
+
** 4-trans-3-oxo-undecenoyl-CoA
+
* inchi key:
+
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
+
* molecular weight:
+
** 943.749   
+
 
* Synonym(s):
 
* Synonym(s):
** 4E-3-oxo-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14793]]
+
* Reaction: [[AMACETOXID-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[THRDLCTCAT-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=AMACETOXID-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
+
{{#set: pathway associated=THRDLCTCAT-PWY}}
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
+
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
+
{{#set: molecular weight=943.749    }}
+
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14793}}
+

Latest revision as of 19:07, 21 March 2018

Gene Tiso_gene_18325

  • Synonym(s):

Reactions associated

Pathways associated

External links