Difference between revisions of "L-CYSTEATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodecanoyl-ACPs Dodecanoyl-ACPs] == * common name: ** a dodecanoyl-[acp] * Synonym(s): ** a dod...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * common name: ** L-cys...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == |
| + | * smiles: | ||
| + | ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** L-cysteate |
| + | * inchi key: | ||
| + | ** InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M | ||
| + | * molecular weight: | ||
| + | ** 168.144 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-cysteic acid |
| − | ** | + | ** 3-sulfoalanine |
| + | ** 2-amino-3-sulfopropionic acid | ||
| + | ** (R)-cysteate | ||
| + | ** 3-sulfo-L-alanine | ||
| + | ** (2R)-2-amino-3-sulfopropanoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11737]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140381 7140381] |
| − | {{#set: | + | * HMDB : HMDB02757 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00506 C00506] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5482600.html 5482600] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58090 58090] | ||
| + | * METABOLIGHTS : MTBLC58090 | ||
| + | {{#set: smiles=C(C([N+])C(=O)[O-])S(=O)(=O)[O-]}} | ||
| + | {{#set: common name=L-cysteate}} | ||
| + | {{#set: inchi key=InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M}} | ||
| + | {{#set: molecular weight=168.144 }} | ||
| + | {{#set: common name=L-cysteic acid|3-sulfoalanine|2-amino-3-sulfopropionic acid|(R)-cysteate|3-sulfo-L-alanine|(2R)-2-amino-3-sulfopropanoic acid}} | ||
| + | {{#set: reversible reaction associated=RXN-11737}} | ||
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite L-CYSTEATE
- smiles:
- C(C([N+])C(=O)[O-])S(=O)(=O)[O-]
- common name:
- L-cysteate
- inchi key:
- InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M
- molecular weight:
- 168.144
- Synonym(s):
- L-cysteic acid
- 3-sulfoalanine
- 2-amino-3-sulfopropionic acid
- (R)-cysteate
- 3-sulfo-L-alanine
- (2R)-2-amino-3-sulfopropanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB02757
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58090
"C(C([N+])C(=O)[O-])S(=O)(=O)[O-" cannot be used as a page name in this wiki.
