Difference between revisions of "PWY-7343"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * common name: ** L-cana...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7343 PWY-7343] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7343 PWY-7343] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* common name: | * common name: | ||
| − | ** | + | ** UDP-glucose biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** UDP-D-glucose biosynthesis |
| − | + | ** UDP-α-D-glucose biosynthesis | |
| − | ** | + | |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[GLUC1PURIDYLTRANS-RXN]] |
| − | == Reaction(s) | + | ** 14 associated gene(s): |
| + | *** [[Tiso_gene_6459]] | ||
| + | *** [[Tiso_gene_4816]] | ||
| + | *** [[Tiso_gene_17531]] | ||
| + | *** [[Tiso_gene_5879]] | ||
| + | *** [[Tiso_gene_17566]] | ||
| + | *** [[Tiso_gene_16930]] | ||
| + | *** [[Tiso_gene_14796]] | ||
| + | *** [[Tiso_gene_9110]] | ||
| + | *** [[Tiso_gene_13477]] | ||
| + | *** [[Tiso_gene_7440]] | ||
| + | *** [[Tiso_gene_11401]] | ||
| + | *** [[Tiso_gene_6457]] | ||
| + | *** [[Tiso_gene_6458]] | ||
| + | *** [[Tiso_gene_7102]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[PHOSPHOGLUCMUT-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_4816]] | ||
| + | *** [[Tiso_gene_13477]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7343 PWY-7343] | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-2759}} |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: common name=UDP-glucose biosynthesis}} | |
| − | + | {{#set: common name=UDP-D-glucose biosynthesis|UDP-α-D-glucose biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: common name= | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:08, 21 March 2018
Pathway PWY-7343
- taxonomic range:
- common name:
- UDP-glucose biosynthesis
- Synonym(s):
- UDP-D-glucose biosynthesis
- UDP-α-D-glucose biosynthesis
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- GLUC1PURIDYLTRANS-RXN
- 14 associated gene(s):
- 4 reconstruction source(s) associated:
- PHOSPHOGLUCMUT-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
