Difference between revisions of "PYRIDOXSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * common name: ** 1-oleoyl...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
| − | ** | + | ** pyridoxal 5'-phosphate biosynthesis I |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin B6 biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''3''' reactions found over '''8''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[DXS-RXN]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_17311]] | ||
| + | ** 7 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[PNPOXI-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_1471]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[PSERTRANSAMPYR-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_17123]] | ||
| + | *** [[Tiso_gene_15686]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.262-RXN 1.1.1.262-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ERYTH4PDEHYDROG-RXN ERYTH4PDEHYDROG-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=ERYTHRON4PDEHYDROG-RXN ERYTHRON4PDEHYDROG-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PDXJ-RXN PDXJ-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8447 RXN-8447] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY] |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=pyridoxal 5'-phosphate biosynthesis I}} | |
| − | + | {{#set: common name=vitamin B6 biosynthesis}} | |
| − | + | {{#set: reaction found=3}} | |
| − | + | {{#set: total reaction=8}} | |
| − | {{#set: | + | {{#set: completion rate=38.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:08, 21 March 2018
Pathway PYRIDOXSYN-PWY
- taxonomic range:
- common name:
- pyridoxal 5'-phosphate biosynthesis I
- Synonym(s):
- vitamin B6 biosynthesis
Reaction(s) found
3 reactions found over 8 reactions in the full pathway
- DXS-RXN
- 1 associated gene(s):
- 7 reconstruction source(s) associated:
- PNPOXI-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PSERTRANSAMPYR-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
