Difference between revisions of "Tiso gene 10743"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_10743 == * right end position: ** 7952 * transcription direction: ** POSITIVE * left end position: ** 5264 * centisome position: ** 63.2008...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10743 == |
− | * | + | * right end position: |
− | ** | + | ** 7952 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5264 |
− | * | + | * centisome position: |
− | ** | + | ** 63.200867 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.1.26.4-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7952}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=5264}} |
− | {{#set: | + | {{#set: centisome position=63.200867 }} |
− | {{#set: | + | {{#set: reaction associated=3.1.26.4-RXN}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:08, 21 March 2018
Gene Tiso_gene_10743
- right end position:
- 7952
- transcription direction:
- POSITIVE
- left end position:
- 5264
- centisome position:
- 63.200867
- Synonym(s):
Reactions associated
- Reaction: 3.1.26.4-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation