Difference between revisions of "PWY-5760"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** β-alanine biosynthesis IV |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-6382]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_3513]] | ||
| + | *** [[Tiso_gene_7322]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9015 RXN-9015] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=β-alanine biosynthesis IV}} | |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:32, 21 March 2018
Pathway PWY-5760
- taxonomic range:
- common name:
- β-alanine biosynthesis IV
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-6382
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
