Difference between revisions of "PWY-5314"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * common name: ** 3-methoxy-4-...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5314 PWY-5314] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5314 PWY-5314] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] | ||
* common name: | * common name: | ||
| − | ** | + | ** L-lysine degradation VIII |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-8173]] |
| − | * [ | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8808 RXN-8808] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1224}} | |
| − | + | {{#set: taxonomic range=TAX-1239}} | |
| − | + | {{#set: common name=L-lysine degradation VIII}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:09, 21 March 2018
Pathway PWY-5314
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-8173
- 0 associated gene:
- 1 reconstruction source(s) associated:
