Difference between revisions of "CPD-12177"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13193 RXN-13193] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * common name: ** (R)-methylmalonate-s...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13193 RXN-13193] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC([CH]=O)C(=O)[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.15.n EC-1.14.15.n]
+
** (R)-methylmalonate-semialdehyde
 +
* inchi key:
 +
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
 +
* molecular weight:
 +
** 101.082   
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-2-methyl-3-oxopropanoate
 +
** (R)-ch3-malonate-semialdehyde
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-130]][c] '''+''' 4 [[PROTON]][c] '''+''' 4 [[Reduced-ferredoxins]][c] '''=>''' 1 [[CPD1F-133]][c] '''+''' 4 [[Oxidized-ferredoxins]][c] '''+''' 2 [[WATER]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14056]]
−
** 2 oxygen[c] '''+''' 1 zeaxanthin[c] '''+''' 4 H+[c] '''+''' 4 a reduced ferredoxin [iron-sulfur] cluster[c] '''=>''' 1 violaxanthin[c] '''+''' 4 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 2 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10919]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14944 14944]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14940 14940]
+
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=(R)-methylmalonate-semialdehyde}}
−
{{#set: ec number=EC-1.14.15.n}}
+
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
−
{{#set: gene associated=Tiso_gene_10919}}
+
{{#set: molecular weight=101.082    }}
−
{{#set: in pathway=}}
+
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: reversible reaction associated=RXN-14056}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 19:09, 21 March 2018

Metabolite CPD-12177

  • smiles:
    • CC([CH]=O)C(=O)[O-]
  • common name:
    • (R)-methylmalonate-semialdehyde
  • inchi key:
    • InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
  • molecular weight:
    • 101.082
  • Synonym(s):
    • (R)-2-methyl-3-oxopropanoate
    • (R)-ch3-malonate-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12177&oldid=39858"