Difference between revisions of "Tiso gene 18831"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=...")
(Created page with "Category:Gene == Gene Tiso_gene_18831 == * right end position: ** 1686 * transcription direction: ** POSITIVE * left end position: ** 179 * centisome position: ** 6.4691...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+
== Gene Tiso_gene_18831 ==
−
* smiles:
+
* right end position:
−
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
** 1686
−
* common name:
+
* transcription direction:
−
** 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M
+
** 179
−
* molecular weight:
+
* centisome position:
−
** 826.095    
+
** 6.4691    
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyronine glucuronide
 
−
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-
 
−
** T3G
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
* [[RXN-10607]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN0-5330]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-7269]]
 +
* [[PWY-7279]]
 +
* [[PWY0-1573]]
 +
* [[PWY0-1567]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-4302]]
 +
* [[PWY0-1568]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1686}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659063 90659063]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
{{#set: left end position=179}}
−
{{#set: common name=3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide}}
+
{{#set: centisome position=6.4691   }}
−
{{#set: inchi key=InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M}}
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|RXN0-5330}}
−
{{#set: molecular weight=826.095   }}
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-7269|PWY-7279|PWY0-1573|PWY0-1567|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302|PWY0-1568}}
−
{{#set: common name=triiodothyronine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-|T3G}}
+
−
{{#set: produced by=RXN-10607}}
+

Latest revision as of 19:10, 21 March 2018

Gene Tiso_gene_18831

  • right end position:
    • 1686
  • transcription direction:
    • POSITIVE
  • left end position:
    • 179
  • centisome position:
    • 6.4691
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18831&oldid=39879"