Difference between revisions of "Tiso gene 19542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
(Created page with "Category:Gene == Gene Tiso_gene_19542 == * right end position: ** 2036 * transcription direction: ** POSITIVE * left end position: ** 26 * centisome position: ** 1.1596788...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
+
== Gene Tiso_gene_19542 ==
−
* smiles:
+
* right end position:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** 2036
−
* common name:
+
* transcription direction:
−
** gibberellin A15 (open lactone form)
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
+
** 26
−
* molecular weight:
+
* centisome position:
−
** 346.422    
+
** 1.1596788    
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin A15
 
−
** GA15
 
−
** GA15 (open lactone form)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-163]]
+
* Reaction: [[GPPSYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN1F-162]]
+
* Reaction: [[R06284]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[RXN-7663]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-7673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7674]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN1F-66]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7736]]
 +
* [[PWY-7764]]
 +
* [[PWY-6859]]
 +
* [[PWY-7709]]
 +
* [[PWY-7102]]
 +
* [[PWY-7182]]
 +
* [[PWY-7141]]
 +
* [[PWY-5123]]
 +
* [[PWY-5122]]
 +
* [[PWY-5064]]
 +
* [[PWY-6383]]
 +
* [[PWY-7659]]
 +
* [[PWY-5068]]
 +
* [[PWY-7410]]
 +
* [[PWY-5086]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170017
+
{{#set: right end position=2036}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
+
{{#set: left end position=26}}
−
* CHEBI:
+
{{#set: centisome position=1.1596788   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
+
{{#set: reaction associated=GPPSYN-RXN|R06284|RXN-7663|RXN-7673|RXN-7674|RXN1F-66}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7736|PWY-7764|PWY-6859|PWY-7709|PWY-7102|PWY-7182|PWY-7141|PWY-5123|PWY-5122|PWY-5064|PWY-6383|PWY-7659|PWY-5068|PWY-7410|PWY-5086}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
+
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: common name=gibberellin A15 (open lactone form)}}
+
−
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
+
−
{{#set: molecular weight=346.422   }}
+
−
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
+
−
{{#set: consumed by=RXN1F-163}}
+
−
{{#set: produced by=RXN1F-162}}
+

Latest revision as of 19:10, 21 March 2018

Gene Tiso_gene_19542

  • right end position:
    • 2036
  • transcription direction:
    • POSITIVE
  • left end position:
    • 26
  • centisome position:
    • 1.1596788
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19542&oldid=39884"