Difference between revisions of "PWY-5664"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * co...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
* common name: | * common name: | ||
| − | ** | + | ** tetrahydrobiopterin biosynthesis II |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | * [[GTP-CYCLOHYDRO-I-RXN]] |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_12736]] |
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.220-RXN 1.1.1.220-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8854 RXN-8854] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33208}} | |
| − | + | {{#set: common name=tetrahydrobiopterin biosynthesis II}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:10, 21 March 2018
Pathway PWY-5664
- taxonomic range:
- common name:
- tetrahydrobiopterin biosynthesis II
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- GTP-CYCLOHYDRO-I-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
