Difference between revisions of "ACACT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * common name: ** 4-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT ACACT] == * direction: ** LEFT-TO-RIGHT * common name: ** Acetyl-CoA C-acetyltransferase * Sy...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT ACACT] ==
* smiles:
+
* direction:
** C(=CC1(=CC=C(O)C=C1))CO
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** 4-coumaryl alcohol
+
** Acetyl-CoA C-acetyltransferase
* inchi key:
+
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
* molecular weight:
+
** 150.177   
+
 
* Synonym(s):
 
* Synonym(s):
** p-coumaryl alcohol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-1102]]
+
** 2.0 [[ACETYL-COA]][c] '''=>''' 1.0 [[ACETOACETYL-COA]][c] '''+''' 1.0 [[CO-A]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2.0 acetyl-CoA[c] '''=>''' 1.0 acetoacetyl-CoA[c] '''+''' 1.0 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15327]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: common name=Acetyl-CoA C-acetyltransferase}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_15327}}
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: in pathway=}}
* HMDB : HMDB03654
+
{{#set: reconstruction category=orthology}}
* CHEBI:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
{{#set: reconstruction tool=pantograph}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
{{#set: common name=4-coumaryl alcohol}}
+
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
{{#set: molecular weight=150.177    }}
+
{{#set: common name=p-coumaryl alcohol}}
+
{{#set: produced by=RXN-1102}}
+

Latest revision as of 19:10, 21 March 2018

Reaction ACACT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Acetyl-CoA C-acetyltransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2.0 acetyl-CoA[c] => 1.0 acetoacetyl-CoA[c] + 1.0 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links