Difference between revisions of "SHIKIMATE-5P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * com...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
+
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
 
* common name:
 
* common name:
−
** traumatin and (Z)-3-hexen-1-yl acetate biosynthesis
+
** shikimate 3-phosphate
 +
* inchi key:
 +
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
 +
* molecular weight:
 +
** 251.109   
 
* Synonym(s):
 
* Synonym(s):
−
** 13-lipoxygenase and 13-hydroperoxide lyase pathway
+
** shikimate 5-phosphate
−
** 13-LOX and 13-HPL pathway
+
** shikimate-5-P
 +
** 3-phosphoshikimate
 +
** shikimate-3-P
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-1321]]
+
== Reaction(s) of unknown directionality ==
−
** 1 associated gene(s):
+
* [[2.5.1.19-RXN]]
−
*** [[Tiso_gene_4463]]
+
* [[SHIKIMATE-KINASE-RXN]]
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROHEX-RXN HYDROHEX-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=LIPOXYGENASE-RXN LIPOXYGENASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11852 RXN-11852]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12299 RXN-12299]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1345 RXN-1345]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1346 RXN-1346]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1347 RXN-1347]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1349 RXN-1349]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5410 PWY-5410]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
−
{{#set: taxonomic range=TAX-3193}}
+
* CHEBI:
−
{{#set: common name=traumatin and (Z)-3-hexen-1-yl acetate biosynthesis}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
−
{{#set: common name=13-lipoxygenase and 13-hydroperoxide lyase pathway|13-LOX and 13-HPL pathway}}
+
* BIGG : skm5p
−
{{#set: reaction found=1}}
+
* LIGAND-CPD:
−
{{#set: total reaction=9}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
−
{{#set: completion rate=11.0}}
+
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
 +
{{#set: common name=shikimate 3-phosphate}}
 +
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
 +
{{#set: molecular weight=251.109    }}
 +
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
 +
{{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}

Latest revision as of 19:11, 21 March 2018

Metabolite SHIKIMATE-5P

  • smiles:
    • C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
  • common name:
    • shikimate 3-phosphate
  • inchi key:
    • InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
  • molecular weight:
    • 251.109
  • Synonym(s):
    • shikimate 5-phosphate
    • shikimate-5-P
    • 3-phosphoshikimate
    • shikimate-3-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SHIKIMATE-5P&oldid=39988"