Difference between revisions of "PWY-6891"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891] ==
* smiles:
+
* taxonomic range:
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** avenasterol
+
** thiazole biosynthesis II (aerobic bacteria)
* inchi key:
+
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
+
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-4209]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[DXS-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_17311]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN0-308]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_4284]]
 +
*** [[Tiso_gene_11478]]
 +
*** [[Tiso_gene_14710]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12609 RXN-12609]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12614 RXN-12614]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12621 RXN-12621]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9789 RXN-9789]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN2-RXN THIAZOLSYN2-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
+
{{#set: common name=thiazole biosynthesis II (aerobic bacteria)}}
* HMDB : HMDB06851
+
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate biosynthesis}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
+
{{#set: total reaction=7}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: completion rate=29.0}}
{{#set: common name=avenasterol}}
+
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: consumed by=RXN-4209}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-6891

  • taxonomic range:
  • common name:
    • thiazole biosynthesis II (aerobic bacteria)
  • Synonym(s):
    • 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate biosynthesis

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links