Difference between revisions of "Tiso gene 1791"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE ADENOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_1791 == * right end position: ** 20654 * transcription direction: ** NEGATIVE * left end position: ** 16540 * centisome position: ** 76.323...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1791 == |
− | * | + | * right end position: |
− | ** | + | ** 20654 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 16540 |
− | * | + | * centisome position: |
− | ** | + | ** 76.3232 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[MONOPHENOL-MONOOXYGENASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | * Reaction: [[RXN-13061]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-5861]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6955]] | ||
+ | * [[PWY-6133]] | ||
+ | * [[PWY-6481]] | ||
+ | * [[PWY-3581]] | ||
+ | * [[PWY-5399]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=20654}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=16540}} | |
− | + | {{#set: centisome position=76.3232 }} | |
− | + | {{#set: reaction associated=MONOPHENOL-MONOOXYGENASE-RXN|RXN-13061|RXN-5861}} | |
− | + | {{#set: pathway associated=PWY-6955|PWY-6133|PWY-6481|PWY-3581|PWY-5399}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:33, 21 March 2018
Gene Tiso_gene_1791
- right end position:
- 20654
- transcription direction:
- NEGATIVE
- left end position:
- 16540
- centisome position:
- 76.3232
- Synonym(s):
Reactions associated
- Reaction: MONOPHENOL-MONOOXYGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-13061
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-5861
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation