Difference between revisions of "CPD-15369"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9600 == * Synonym(s): == Reactions associated == * Reaction: ADENOSINETRIPHOSPHATASE-RXN ** Source: orthology-esiliculosus == Path...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == |
| + | * smiles: | ||
| + | ** CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
| + | * common name: | ||
| + | ** 3R-hydroxy-lesqueroloyl-CoA | ||
| + | * inchi key: | ||
| + | ** InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J | ||
| + | * molecular weight: | ||
| + | ** 1088.005 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-14493]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819813 91819813] | ||
| + | {{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
| + | {{#set: common name=3R-hydroxy-lesqueroloyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J}} | ||
| + | {{#set: molecular weight=1088.005 }} | ||
| + | {{#set: produced by=RXN-14493}} | ||
Latest revision as of 19:12, 21 March 2018
Contents
Metabolite CPD-15369
- smiles:
- CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- 3R-hydroxy-lesqueroloyl-CoA
- inchi key:
- InChIKey=CHMQNMKVOYFHHX-SGPQCWJRSA-J
- molecular weight:
- 1088.005
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC(O)CC=CCCCCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
