Difference between revisions of "RXN-9659"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8606 CPD-8606] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acp] reduc...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8606 CPD-8606] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 24,25-dihydrolanosterol
+
** trans oct-2-enoyl-[acp] reductase
−
* inchi key:
+
* ec number:
−
** InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
−
* molecular weight:
+
−
** 428.74   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol
 
−
** 5alpha-lanost-8-en-3beta-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-11]]
+
* With identifiers:
−
* [[RXN-13707]]
+
** 1 [[2-Octenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a trans oct-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 an octanoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440560 440560]
+
{{#set: common name=trans oct-2-enoyl-[acp] reductase}}
−
* HMDB : HMDB06839
+
{{#set: ec number=EC-1.3.1.9}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_10778}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05109 C05109]
+
{{#set: in pathway=PWY-5971}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.chemspider.com/Chemical-Structure.5140691.html 5140691]
+
{{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28113 28113]
+
−
* METABOLIGHTS : MTBLC28113
+
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
−
{{#set: common name=24,25-dihydrolanosterol}}
+
−
{{#set: inchi key=InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N}}
+
−
{{#set: molecular weight=428.74    }}
+
−
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol|5alpha-lanost-8-en-3beta-ol}}
+
−
{{#set: consumed by=RXN66-11|RXN-13707}}
+

Latest revision as of 19:14, 21 March 2018

Reaction RXN-9659

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans oct-2-enoyl-[acp] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a trans oct-2-enoyl-[acp][c] + 1 NADH[c] + 1 H+[c] => 1 an octanoyl-[acp][c] + 1 NAD+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans oct-2-enoyl-[acp] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9659&oldid=40354"