Difference between revisions of "CPD-10826"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11065 RXN-11065] == * direction: ** LEFT-TO-RIGHT * common name: ** beta-lactamase * ec number:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * common name: ** 4-methyl-3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] |
* common name: | * common name: | ||
| − | ** | + | ** 4-methyl-3-oxoadipate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L |
| + | * molecular weight: | ||
| + | ** 172.137 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-methyl-3-ketoadipate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10083]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441] |
| − | + | {{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}} | |
| − | {{#set: | + | {{#set: common name=4-methyl-3-oxoadipate}} |
| − | + | {{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}} | |
| − | {{#set: | + | {{#set: molecular weight=172.137 }} |
| − | {{#set: | + | {{#set: common name=4-methyl-3-ketoadipate}} |
| − | {{#set: | + | {{#set: produced by=RXN-10083}} |
Latest revision as of 19:15, 21 March 2018
Contents
Metabolite CPD-10826
- smiles:
- CC(C(=O)CC(=O)[O-])CC(=O)[O-]
- common name:
- 4-methyl-3-oxoadipate
- inchi key:
- InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
- molecular weight:
- 172.137
- Synonym(s):
- 4-methyl-3-ketoadipate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C(=O)CC(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.
