Difference between revisions of "Cyclic-Phosphate-Terminated-RNAs"

Latest revision as of 19:15, 21 March 2018

common name:
- an [RNA]-3'-(2',3'-cyclophospho)-ribunucleoside
Synonym(s):
- a 2',3'-cyclic-phosphate-terminated RNA
- an RNA terminal-2',3'-cyclic-phosphate

"an [RNA]-3'-(2',3'-cyclophospho)-ribunucleoside" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cyclic-Phosphate-Terminated-RNAs Cyclic-Phosphate-Terminated-RNAs] ==
-* smiles:
-** CC(C(=O)CC(=O)[O-])CC(=O)[O-]
 * common name:
-** 4-methyl-3-oxoadipate
+** an [RNA]-3'-(2',3'-cyclophospho)-ribunucleoside
-* inchi key:
-** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
-* molecular weight:
-** 172.137
 * Synonym(s):
-** 4-methyl-3-ketoadipate
+** a 2',3'-cyclic-phosphate-terminated RNA
+** an RNA terminal-2',3'-cyclic-phosphate
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-10083]]
+* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=an [RNA]-3'-(2',3'-cyclophospho)-ribunucleoside}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441]
+{{#set: common name=a 2',3'-cyclic-phosphate-terminated RNA|an RNA terminal-2',3'-cyclic-phosphate}}
-{{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}}
+{{#set: produced by=RNA-3-PHOSPHATE-CYCLASE-RXN}}
-{{#set: common name=4-methyl-3-oxoadipate}}
-{{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}}
-{{#set: molecular weight=172.137    }}
-{{#set: common name=4-methyl-3-ketoadipate}}
-{{#set: produced by=RXN-10083}}