Difference between revisions of "RXN-14775"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * smiles: ** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S * inchi key: ** InCh...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14775 RXN-14775] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14775 RXN-14775] ==
−
* smiles:
+
* direction:
−
** COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RLBIQVVOMOPOHC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** methyl parathion
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
* ec number:
−
** 263.204   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** dimethyl-parathion
 
−
** parathion-methyl
 
−
** methyl paration
 
−
** methylthiophos
 
−
** cekumethion
 
−
** oleovofotox
 
−
** thiophenit
 
−
** devithion
 
−
** metacide
 
−
** metaphos
 
−
** quinophos
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8743]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-15668]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-15654]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 4-cis-undecenoyl-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 2-trans, 4-cis-undecadienoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7337]], 10-cis-heptadecenoyl-CoA degradation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7337 PWY-7337]
 +
** '''3''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4130 4130]
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.3.6}}
−
** [http://www.chemspider.com/Chemical-Structure.3987.html 3987]
+
{{#set: gene associated=Tiso_gene_18566}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7337}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38746 38746]
+
{{#set: reconstruction category=orthology|annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14228 C14228]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=COP(OC1(=CC=C(C=C1)[N+](=O)[O-]))(OC)=S}}
+
−
{{#set: inchi key=InChIKey=RLBIQVVOMOPOHC-UHFFFAOYSA-N}}
+
−
{{#set: common name=methyl parathion}}
+
−
{{#set: molecular weight=263.204    }}
+
−
{{#set: common name=dimethyl-parathion|parathion-methyl|methyl paration|methylthiophos|cekumethion|oleovofotox|thiophenit|devithion|metacide|metaphos|quinophos}}
+
−
{{#set: consumed by=RXN-8743}}
+

Latest revision as of 19:33, 21 March 2018

Reaction RXN-14775

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7337, 10-cis-heptadecenoyl-CoA degradation (yeast): PWY-7337
    • 3 reactions found over 12 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14775&oldid=42354"