Difference between revisions of "Ubiquinols"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinols Ubiquinols] == * common name: ** an ubiquinol * Synonym(s): ** a reduced ubiquinone...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquinols Ubiquinols] ==
* smiles:
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
 
* common name:
 
* common name:
** bisorganyltrisulfane
+
** an ubiquinol
* inchi key:
+
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
* molecular weight:
+
** 644.686   
+
 
* Synonym(s):
 
* Synonym(s):
** GS3G
+
** a reduced ubiquinone
 +
** a dihydroubiquinone
 +
** a QH2
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-6883]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5330]]
 +
* [[RXN0-5260]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
* [[RXN0-6491]]
 +
* [[RXN-15829]]
 +
* [[RXN0-5244]]
 +
* [[RXN0-7008]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10851]]
+
* [[1.10.2.2-RXN]]
 +
* [[NADH-DEHYDROG-A-RXN]]
 +
* [[1.5.5.1-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an ubiquinol}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: common name=a reduced ubiquinone|a dihydroubiquinone|a QH2}}
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: consumed by=RXN-6883}}
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: produced by=RXN0-5330|RXN0-5260|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN|RXN0-6491|RXN-15829|RXN0-5244|RXN0-7008}}
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: reversible reaction associated=1.10.2.2-RXN|NADH-DEHYDROG-A-RXN|1.5.5.1-RXN}}
{{#set: molecular weight=644.686    }}
+
{{#set: common name=GS3G}}
+
{{#set: reversible reaction associated=RXN-10851}}
+

Latest revision as of 19:17, 21 March 2018

Metabolite Ubiquinols

  • common name:
    • an ubiquinol
  • Synonym(s):
    • a reduced ubiquinone
    • a dihydroubiquinone
    • a QH2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links