Difference between revisions of "2-KETO-3-DEOXY-D-GLUCARATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16909 RXN-16909] == * direction: ** LEFT-TO-RIGHT * common name: ** carbamoyl_phosphate_synthet...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] == * smiles: ** C(C(CC(C(C([O-])=O)O)O)=...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16909 RXN-16909] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-DEOXY-D-GLUCARATE 2-KETO-3-DEOXY-D-GLUCARATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O
 
* common name:
 
* common name:
−
** carbamoyl_phosphate_synthetase
+
** (2S,3S)-2,3-dihydroxy-5-oxohexanedioate
−
** protein_pyr1-3
+
* inchi key:
 +
** InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L
 +
* molecular weight:
 +
** 190.109   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-deoxy-L-allo-hex-2-ulosarate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[HCO3]][c] '''=>''' 1 [[CPD-18238]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[4.1.2.20-RXN]]
−
** 1 ATP[c] '''+''' 1 hydrogencarbonate[c] '''=>''' 1 carboxyphosphate[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_4976]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_4685]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_4975]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7693]], guadinomine B biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7693 PWY-7693]
+
−
** '''3''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=carbamoyl_phosphate_synthetase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245202 25245202]
−
{{#set: common name=protein_pyr1-3}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_4976|Tiso_gene_4685|Tiso_gene_4975}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58098 58098]
−
{{#set: in pathway=PWY-7693}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03921 C03921]
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
{{#set: smiles=C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=(2S,3S)-2,3-dihydroxy-5-oxohexanedioate}}
 +
{{#set: inchi key=InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L}}
 +
{{#set: molecular weight=190.109    }}
 +
{{#set: common name=3-deoxy-L-allo-hex-2-ulosarate}}
 +
{{#set: reversible reaction associated=4.1.2.20-RXN}}

Latest revision as of 19:17, 21 March 2018

Metabolite 2-KETO-3-DEOXY-D-GLUCARATE

  • smiles:
    • C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O
  • common name:
    • (2S,3S)-2,3-dihydroxy-5-oxohexanedioate
  • inchi key:
    • InChIKey=QUURPCHWPQNNGL-OKKQSCSOSA-L
  • molecular weight:
    • 190.109
  • Synonym(s):
    • 3-deoxy-L-allo-hex-2-ulosarate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CC(C(C([O-])=O)O)O)=O)([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-KETO-3-DEOXY-D-GLUCARATE&oldid=40608"