Difference between revisions of "Tiso gene 11453"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_11453 == * right end position: ** 4168 * transcription direction: ** POSITIVE * left end position: ** 5 * centisome position: ** 6.41930940...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11453 == |
− | * | + | * right end position: |
− | ** | + | ** 4168 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5 |
− | * | + | * centisome position: |
− | ** | + | ** 6.41930940e-2 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2-ISOPROPYLMALATESYN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
− | * [[RXN- | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | * Reaction: [[IPMS]] |
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-7743]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5101]] | ||
+ | * [[LEUSYN-PWY]] | ||
+ | * [[PWY-6871]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4168}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5}} | |
− | + | {{#set: centisome position=6.41930940e-2}} | |
− | + | {{#set: reaction associated=2-ISOPROPYLMALATESYN-RXN|IPMS|RXN-7743}} | |
− | + | {{#set: pathway associated=PWY-5101|LEUSYN-PWY|PWY-6871}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:33, 21 March 2018
Gene Tiso_gene_11453
- right end position:
- 4168
- transcription direction:
- POSITIVE
- left end position:
- 5
- centisome position:
- 6.41930940e-2
- Synonym(s):
Reactions associated
- Reaction: 2-ISOPROPYLMALATESYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: IPMS
- Source: orthology-creinhardtii
- Reaction: RXN-7743
- Source: orthology-synechocystis