Difference between revisions of "INOSITOL-1-3-4-TRIPHOSPHATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCHMSSELCYSL SUCHMSSELCYSL] == * direction: ** LEFT-TO-RIGHT * common name: ** O-Succinyl-L-homose...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1) |
* common name: | * common name: | ||
− | ** | + | ** D-myo-inositol (1,3,4)-trisphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H | ||
+ | * molecular weight: | ||
+ | ** 414.049 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Ins(1,3,4)P3 | ||
+ | ** 1-D-myo-inositol (1,3,4)-trisphosphate | ||
+ | ** inositol 1,3,4-trisphosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[2.7.1.139-RXN]] |
− | + | * [[RXN-10959]] | |
− | * | + | * [[RXN-10939]] |
− | + | * [[2.7.1.133-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-8730]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243] |
− | {{#set: | + | * HMDB : HMDB01143 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58414 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948] | ||
+ | {{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}} | ||
+ | {{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}} | ||
+ | {{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}} | ||
+ | {{#set: molecular weight=414.049 }} | ||
+ | {{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}} | ||
+ | {{#set: consumed by=2.7.1.139-RXN|RXN-10959|RXN-10939|2.7.1.133-RXN}} | ||
+ | {{#set: produced by=RXN-8730}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite INOSITOL-1-3-4-TRIPHOSPHATE
- smiles:
- C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
- common name:
- D-myo-inositol (1,3,4)-trisphosphate
- inchi key:
- InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
- molecular weight:
- 414.049
- Synonym(s):
- Ins(1,3,4)P3
- 1-D-myo-inositol (1,3,4)-trisphosphate
- inositol 1,3,4-trisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.