Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18379 CPD-18379] == * smiles: ** CCCCCCCCCCCCCC(=O)OCC(O)COP(=O)([O-])[O-] * common name: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * smiles: ** C(CC(=O)OCCC(C([O-])=O)[N+])C(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O |
* common name: | * common name: | ||
| − | ** | + | ** O-succinyl-L-homoserine |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 218.186 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** O-succinyl-homoserine |
| + | ** succinyl-homoserine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[SUCHMSSELCYSLh]] |
| − | * [[ | + | * [[METBALT-RXN]] |
| − | + | * [[SUCHMSSELCYSL]] | |
| − | * [[ | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
| + | * [[RXN-9384]] | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 1492-23-5 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661] |
| − | * BIGG : | + | * BIGG : suchms |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}} |
| − | {{#set: molecular weight= | + | {{#set: common name=O-succinyl-L-homoserine}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}} |
| − | {{#set: consumed by= | + | {{#set: molecular weight=218.186 }} |
| + | {{#set: common name=O-succinyl-homoserine|succinyl-homoserine}} | ||
| + | {{#set: consumed by=SUCHMSSELCYSLh|METBALT-RXN|SUCHMSSELCYSL}} | ||
| + | {{#set: reversible reaction associated=O-SUCCHOMOSERLYASE-RXN|RXN-9384}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- smiles:
- C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
- common name:
- O-succinyl-L-homoserine
- inchi key:
- InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
- molecular weight:
- 218.186
- Synonym(s):
- O-succinyl-homoserine
- succinyl-homoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O" cannot be used as a page name in this wiki.
